About 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea
1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea (PubChem CID 174330937) has the molecular formula C6H13N5O
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea.
Molecular Properties
| Compound Name | 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea |
| PubChem CID | 174330937 |
| Molecular Formula | C6H13N5O |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea |
| SMILES | C/N=C/N(C)C(=O)N/C(N)=N/C |
| InChI | InChI=1S/C6H13N5O/c1-8-4-11(3)6(12)10-5(7)9-2/h4H,1-3H3,(H3,7,9,10,12)/b8-4+ |
| InChIKey | VANJESGSMXDMBA-XBXARRHUSA-N |
| XLogP | -0.77 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea?
The IUPAC name of 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea (CID 174330937) is 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea.
What is the SMILES notation for 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea?
The canonical SMILES for 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea is C/N=C/N(C)C(=O)N/C(N)=N/C.
What is the InChIKey of 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea?
The InChIKey is VANJESGSMXDMBA-XBXARRHUSA-N. The full InChI is InChI=1S/C6H13N5O/c1-8-4-11(3)6(12)10-5(7)9-2/h4H,1-3H3,(H3,7,9,10,12)/b8-4+.
What are the key properties of 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea?
1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea has a molecular weight of 171.20 g/mol, XLogP of -0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(N'-methylcarbamimidoyl)-1-(methyliminomethyl)urea is sourced from PubChem (CID 174330937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).