C8H20N6 — CID 148897380
1,1,3,3-tetramethyl-2-[[(N'-methylcarbamimidoyl)amino]methyl]guanidine (PubChem CID 148897380) has the molecular formula C8H20N6 and a molecular weight of 200.29 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[[(N'-methylcarbamimidoyl)amino]methyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[[(N'-methylcarbamimidoyl)amino]methyl]guanidine |
|---|---|
| PubChem CID | 148897380 |
| Molecular Formula | C8H20N6 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[[(N'-methylcarbamimidoyl)amino]methyl]guanidine |
| SMILES | C/N=C(\N)NCN=C(N(C)C)N(C)C |
| InChI | InChI=1S/C8H20N6/c1-10-7(9)11-6-12-8(13(2)3)14(4)5/h6H2,1-5H3,(H3,9,10,11) |
| InChIKey | PGCVYMBVTFSDEY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|