C6H14N4O — CID 62359742
N-methyl-3-[(N'-methylcarbamimidoyl)amino]propanamide (PubChem CID 62359742) has the molecular formula C6H14N4O and a molecular weight of 158.21 g/mol. Its IUPAC name is N-methyl-3-[(N'-methylcarbamimidoyl)amino]propanamide.
| Compound Name | N-methyl-3-[(N'-methylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 62359742 |
| Molecular Formula | C6H14N4O |
| Molecular Weight | 158.21 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | N-methyl-3-[(N'-methylcarbamimidoyl)amino]propanamide |
| SMILES | C/N=C(\N)NCCC(=O)NC |
| InChI | InChI=1S/C6H14N4O/c1-8-5(11)3-4-10-6(7)9-2/h3-4H2,1-2H3,(H,8,11)(H3,7,9,10) |
| InChIKey | NCAMEXHPCMLCRY-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.21 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|