C8H18N4O — CID 115600936
3-[(N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide (PubChem CID 115600936) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is 3-[(N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[(N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 115600936 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 3-[(N'-methylcarbamimidoyl)amino]-N-propan-2-ylpropanamide |
| SMILES | C/N=C(\N)NCCC(=O)NC(C)C |
| InChI | InChI=1S/C8H18N4O/c1-6(2)12-7(13)4-5-11-8(9)10-3/h6H,4-5H2,1-3H3,(H,12,13)(H3,9,10,11) |
| InChIKey | JEOLDWDCROEMSZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|