About 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate
2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate (PubChem CID 83203999) has the molecular formula C5H12N4O2
and a molecular weight of 160.18 g/mol. Its IUPAC name is 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate |
| PubChem CID | 83203999 |
| Molecular Formula | C5H12N4O2 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate |
| SMILES | C/N=C(\N)NCCOC(N)=O |
| InChI | InChI=1S/C5H12N4O2/c1-8-4(6)9-2-3-11-5(7)10/h2-3H2,1H3,(H2,7,10)(H3,6,8,9) |
| InChIKey | SGDODYUELWUKQK-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate?
The IUPAC name of 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate (CID 83203999) is 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate.
What is the SMILES notation for 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate?
The canonical SMILES for 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate is C/N=C(\N)NCCOC(N)=O.
What is the InChIKey of 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate?
The InChIKey is SGDODYUELWUKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O2/c1-8-4(6)9-2-3-11-5(7)10/h2-3H2,1H3,(H2,7,10)(H3,6,8,9).
What are the key properties of 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate?
2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate has a molecular weight of 160.18 g/mol, XLogP of -1.38, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N'-methylcarbamimidoyl)amino]ethyl carbamate is sourced from PubChem (CID 83203999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).