About 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate
2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate (PubChem CID 177489322) has the molecular formula C4H10N4O3
and a molecular weight of 162.15 g/mol. Its IUPAC name is 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate |
| PubChem CID | 177489322 |
| Molecular Formula | C4H10N4O3 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate |
| SMILES | C/N=C(\N)NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C4H10N4O3/c1-6-4(5)7-2-3-11-8(9)10/h2-3H2,1H3,(H3,5,6,7) |
| InChIKey | AHECEORWYJYJQV-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate?
The IUPAC name of 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate (CID 177489322) is 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate.
What is the SMILES notation for 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate?
The canonical SMILES for 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate is C/N=C(\N)NCCO[N+](=O)[O-].
What is the InChIKey of 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate?
The InChIKey is AHECEORWYJYJQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4O3/c1-6-4(5)7-2-3-11-8(9)10/h2-3H2,1H3,(H3,5,6,7).
What are the key properties of 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate?
2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate has a molecular weight of 162.15 g/mol, XLogP of -1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N'-methylcarbamimidoyl)amino]ethyl nitrate is sourced from PubChem (CID 177489322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).