C7H17N3O2 — CID 103975187
1-[3-(2-hydroxyethoxy)propyl]-2-methylguanidine (PubChem CID 103975187) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-[3-(2-hydroxyethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[3-(2-hydroxyethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 103975187 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | 1-[3-(2-hydroxyethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCCOCCO |
| InChI | InChI=1S/C7H17N3O2/c1-9-7(8)10-3-2-5-12-6-4-11/h11H,2-6H2,1H3,(H3,8,9,10) |
| InChIKey | LWHNGKNONFTXKG-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|