C13H25NO4 — CID 114171186
N-[3-(2-hydroxyethoxy)propyl]-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 114171186) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[3-(2-hydroxyethoxy)propyl]-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-[3-(2-hydroxyethoxy)propyl]-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 114171186 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N-[3-(2-hydroxyethoxy)propyl]-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)NCCCOCCO)C1C |
| InChI | InChI=1S/C13H25NO4/c1-9-10(2)18-11(3)12(9)13(16)14-5-4-7-17-8-6-15/h9-12,15H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | CEXICHNVYCNLCD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|