C13H24BrNO3 — CID 106245062
N-(3-bromo-4-methoxybutyl)-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 106245062) has the molecular formula C13H24BrNO3 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 106245062 |
| Molecular Formula | C13H24BrNO3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | COCC(Br)CCNC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C13H24BrNO3/c1-8-9(2)18-10(3)12(8)13(16)15-6-5-11(14)7-17-4/h8-12H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | DFTCRNZUJVVDCC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|