C29H40N4O6 — CID 158622214
9H-fluoren-9-ylmethyl (3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-6-[(N'-methylcarbamimidoyl)amino]hexanoate (PubChem CID 158622214) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-6-[(N'-methylcarbamimidoyl)amino]hexanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-6-[(N'-methylcarbamimidoyl)amino]hexanoate |
|---|---|
| PubChem CID | 158622214 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3R)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-6-[(N'-methylcarbamimidoyl)amino]hexanoate |
| SMILES | C/N=C(\N)NCCCC(CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCCOCCOCCO |
| InChI | InChI=1S/C29H40N4O6/c1-31-29(30)33-12-6-7-21(28(36)32-13-15-37-17-18-38-16-14-34)19-27(35)39-20-26-24-10-4-2-8-22(24)23-9-3-5-11-25(23)26/h2-5,8-11,21,26,34H,6-7,12-20H2,1H3,(H,32,36)(H3,30,31,33) |
| InChIKey | WJJJPDVHVWVNLV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|