C29H26F5NO3 — CID 157165859
9H-fluoren-9-ylmethyl 4-(butylamino)-4-oxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]butanoate (PubChem CID 157165859) has the molecular formula C29H26F5NO3 and a molecular weight of 531.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-(butylamino)-4-oxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]butanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-(butylamino)-4-oxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]butanoate |
|---|---|
| PubChem CID | 157165859 |
| Molecular Formula | C29H26F5NO3 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-(butylamino)-4-oxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]butanoate |
| SMILES | CCCCNC(=O)C(CC(=O)OCC1c2ccccc2-c2ccccc21)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H26F5NO3/c1-2-3-12-35-29(37)16(13-21-24(30)26(32)28(34)27(33)25(21)31)14-23(36)38-15-22-19-10-6-4-8-17(19)18-9-5-7-11-20(18)22/h4-11,16,22H,2-3,12-15H2,1H3,(H,35,37) |
| InChIKey | AMXBKXKIVCQRJA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|