About N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide
N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide (PubChem CID 123137828) has the molecular formula C9H20N4O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide |
| PubChem CID | 123137828 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide |
| SMILES | C/N=C(\N)NCCCCC(=O)NCCO |
| InChI | InChI=1S/C9H20N4O2/c1-11-9(10)13-5-3-2-4-8(15)12-6-7-14/h14H,2-7H2,1H3,(H,12,15)(H3,10,11,13) |
| InChIKey | ZNNLSPPNRKEZBP-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide?
The IUPAC name of N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide (CID 123137828) is N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide.
What is the SMILES notation for N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide?
The canonical SMILES for N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide is C/N=C(\N)NCCCCC(=O)NCCO.
What is the InChIKey of N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide?
The InChIKey is ZNNLSPPNRKEZBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4O2/c1-11-9(10)13-5-3-2-4-8(15)12-6-7-14/h14H,2-7H2,1H3,(H,12,15)(H3,10,11,13).
What are the key properties of N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide?
N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide has a molecular weight of 216.28 g/mol, XLogP of -1.20, 7 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-5-[(N'-methylcarbamimidoyl)amino]pentanamide is sourced from PubChem (CID 123137828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).