C5H13N3O — CID 130678429
1-[(2S)-2-hydroxypropyl]-2-methylguanidine (PubChem CID 130678429) has the molecular formula C5H13N3O and a molecular weight of 131.18 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxypropyl]-2-methylguanidine.
| Compound Name | 1-[(2S)-2-hydroxypropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 130678429 |
| Molecular Formula | C5H13N3O |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 1-[(2S)-2-hydroxypropyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NC[C@H](C)O |
| InChI | InChI=1S/C5H13N3O/c1-4(9)3-8-5(6)7-2/h4,9H,3H2,1-2H3,(H3,6,7,8)/t4-/m0/s1 |
| InChIKey | IUZCLFQSXSWPAS-BYPYZUCNSA-N |
| XLogP | -1.10 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|