C14H29NO2 — CID 88557518
2-tert-butyl-N-(2-hydroxypropyl)-2,3,3-trimethylbutanamide (PubChem CID 88557518) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-tert-butyl-N-(2-hydroxypropyl)-2,3,3-trimethylbutanamide.
| Compound Name | 2-tert-butyl-N-(2-hydroxypropyl)-2,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 88557518 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 2-tert-butyl-N-(2-hydroxypropyl)-2,3,3-trimethylbutanamide |
| SMILES | CC(O)CNC(=O)C(C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H29NO2/c1-10(16)9-15-11(17)14(8,12(2,3)4)13(5,6)7/h10,16H,9H2,1-8H3,(H,15,17) |
| InChIKey | ZRUIAZJRMDQTPW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |