C11H21NO2 — CID 72589795
5-(2-hydroxypropylamino)-2,2-dimethylhex-4-en-3-one (PubChem CID 72589795) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 5-(2-hydroxypropylamino)-2,2-dimethylhex-4-en-3-one.
| Compound Name | 5-(2-hydroxypropylamino)-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 72589795 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 5-(2-hydroxypropylamino)-2,2-dimethylhex-4-en-3-one |
| SMILES | CC(=CC(=O)C(C)(C)C)NCC(C)O |
| InChI | InChI=1S/C11H21NO2/c1-8(12-7-9(2)13)6-10(14)11(3,4)5/h6,9,12-13H,7H2,1-5H3 |
| InChIKey | ZMKMYTNEXXEWRC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|