C7H20N8 — CID 160881255
1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine (PubChem CID 160881255) has the molecular formula C7H20N8 and a molecular weight of 216.29 g/mol. Its IUPAC name is 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine.
| Compound Name | 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine |
|---|---|
| PubChem CID | 160881255 |
| Molecular Formula | C7H20N8 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine |
| SMILES | C/N=C(\N)N/C(N)=N/C.C/N=C(\N)NC |
| InChI | InChI=1S/C4H11N5.C3H9N3/c1-7-3(5)9-4(6)8-2;1-5-3(4)6-2/h1-2H3,(H5,5,6,7,8,9);1-2H3,(H3,4,5,6) |
| InChIKey | SNBCZKSQKZEXTA-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|