About 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine
1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine (PubChem CID 160881255) has the molecular formula C7H20N8
and a molecular weight of 216.29 g/mol. Its IUPAC name is 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine.
Molecular Properties
| Compound Name | 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine |
| PubChem CID | 160881255 |
| Molecular Formula | C7H20N8 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine |
| SMILES | C/N=C(\N)N/C(N)=N/C.C/N=C(\N)NC |
| InChI | InChI=1S/C4H11N5.C3H9N3/c1-7-3(5)9-4(6)8-2;1-5-3(4)6-2/h1-2H3,(H5,5,6,7,8,9);1-2H3,(H3,4,5,6) |
| InChIKey | SNBCZKSQKZEXTA-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine?
The IUPAC name of 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine (CID 160881255) is 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine.
What is the SMILES notation for 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine?
The canonical SMILES for 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine is C/N=C(\N)N/C(N)=N/C.C/N=C(\N)NC.
What is the InChIKey of 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine?
The InChIKey is SNBCZKSQKZEXTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5.C3H9N3/c1-7-3(5)9-4(6)8-2;1-5-3(4)6-2/h1-2H3,(H5,5,6,7,8,9);1-2H3,(H3,4,5,6).
What are the key properties of 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine?
1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine has a molecular weight of 216.29 g/mol, XLogP of -2.38, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylguanidine;2-methyl-1-(N'-methylcarbamimidoyl)guanidine is sourced from PubChem (CID 160881255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).