C10H23N5 — CID 155006634
1-[(E)-4,4-dimethyl-5-(2-methylhydrazinyl)pent-2-en-2-yl]-2-methylguanidine (PubChem CID 155006634) has the molecular formula C10H23N5 and a molecular weight of 213.33 g/mol. Its IUPAC name is 1-[(E)-4,4-dimethyl-5-(2-methylhydrazinyl)pent-2-en-2-yl]-2-methylguanidine.
| Compound Name | 1-[(E)-4,4-dimethyl-5-(2-methylhydrazinyl)pent-2-en-2-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 155006634 |
| Molecular Formula | C10H23N5 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.20 |
| IUPAC Name | 1-[(E)-4,4-dimethyl-5-(2-methylhydrazinyl)pent-2-en-2-yl]-2-methylguanidine |
| SMILES | C/N=C(\N)N/C(C)=C/C(C)(C)CNNC |
| InChI | InChI=1S/C10H23N5/c1-8(15-9(11)12-4)6-10(2,3)7-14-13-5/h6,13-14H,7H2,1-5H3,(H3,11,12,15)/b8-6+ |
| InChIKey | JGKGFHMIJXORAO-SOFGYWHQSA-N |
| XLogP | 0.17 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|