C16H27N3 — CID 109467640
1-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-methylguanidine (PubChem CID 109467640) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109467640 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCC(C)(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27N3/c1-15(2,3)12-7-9-13(10-8-12)16(4,5)11-19-14(17)18-6/h7-10H,11H2,1-6H3,(H3,17,18,19) |
| InChIKey | HDXQVBCZEZWHAI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|