C13H21ClIN3 — CID 110920824
1-[2-(4-chlorophenyl)-2-methylpropyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110920824) has the molecular formula C13H21ClIN3 and a molecular weight of 381.69 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-methylpropyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)-2-methylpropyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110920824 |
| Molecular Formula | C13H21ClIN3 |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-methylpropyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCC(C)(C)c1ccc(Cl)cc1.I |
| InChI | InChI=1S/C13H20ClN3.HI/c1-13(2,9-17-12(15-3)16-4)10-5-7-11(14)8-6-10;/h5-8H,9H2,1-4H3,(H2,15,16,17);1H |
| InChIKey | XYOCOIZNNNEZAC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|