About 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride
1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride (PubChem CID 162304757) has the molecular formula C11H18ClN5
and a molecular weight of 255.75 g/mol. Its IUPAC name is 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride |
| PubChem CID | 162304757 |
| Molecular Formula | C11H18ClN5 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride |
| SMILES | C/N=C(\N)N/C(N)=N/Cc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C11H17N5.ClH/c1-8-3-5-9(6-4-8)7-15-11(13)16-10(12)14-2;/h3-6H,7H2,1-2H3,(H5,12,13,14,15,16);1H |
| InChIKey | DCXPYQPZFKGRFM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride?
The IUPAC name of 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride (CID 162304757) is 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride.
What is the SMILES notation for 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride?
The canonical SMILES for 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride is C/N=C(\N)N/C(N)=N/Cc1ccc(C)cc1.Cl.
What is the InChIKey of 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride?
The InChIKey is DCXPYQPZFKGRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5.ClH/c1-8-3-5-9(6-4-8)7-15-11(13)16-10(12)14-2;/h3-6H,7H2,1-2H3,(H5,12,13,14,15,16);1H.
What are the key properties of 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride?
1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride has a molecular weight of 255.75 g/mol, XLogP of 0.77, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N'-methylcarbamimidoyl)-2-[(4-methylphenyl)methyl]guanidine;hydrochloride is sourced from PubChem (CID 162304757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).