C9H15N5O3 — CID 23618037
1-amino-2-[(4-methylphenyl)methyl]guanidine;nitric acid (PubChem CID 23618037) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-amino-2-[(4-methylphenyl)methyl]guanidine;nitric acid.
| Compound Name | 1-amino-2-[(4-methylphenyl)methyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 23618037 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-amino-2-[(4-methylphenyl)methyl]guanidine;nitric acid |
| SMILES | Cc1ccc(C/N=C(\N)NN)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C9H14N4.HNO3/c1-7-2-4-8(5-3-7)6-12-9(10)13-11;2-1(3)4/h2-5H,6,11H2,1H3,(H3,10,12,13);(H,2,3,4) |
| InChIKey | SBOXKJMKCAVWCF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|