C11H18N4 — CID 116512550
1-amino-3-ethyl-2-[(4-methylphenyl)methyl]guanidine (PubChem CID 116512550) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-amino-3-ethyl-2-[(4-methylphenyl)methyl]guanidine.
| Compound Name | 1-amino-3-ethyl-2-[(4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 116512550 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-amino-3-ethyl-2-[(4-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NN |
| InChI | InChI=1S/C11H18N4/c1-3-13-11(15-12)14-8-10-6-4-9(2)5-7-10/h4-7H,3,8,12H2,1-2H3,(H2,13,14,15) |
| InChIKey | ZIOKDOCFGJVWLV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|