C6H18N6 — CID 155384700
guanidine;1,1,2,3-tetramethylguanidine (PubChem CID 155384700) has the molecular formula C6H18N6 and a molecular weight of 174.25 g/mol. Its IUPAC name is guanidine;1,1,2,3-tetramethylguanidine.
| Compound Name | guanidine;1,1,2,3-tetramethylguanidine |
|---|---|
| PubChem CID | 155384700 |
| Molecular Formula | C6H18N6 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | guanidine;1,1,2,3-tetramethylguanidine |
| SMILES | C/N=C(/NC)N(C)C.[H]N=C(N)N |
| InChI | InChI=1S/C5H13N3.CH5N3/c1-6-5(7-2)8(3)4;2-1(3)4/h1-4H3,(H,6,7);(H5,2,3,4) |
| InChIKey | BPJGHELRUHDUSW-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|