C7H13N3 — CID 87802569
1,2,3-trimethyl-1-prop-1-ynylguanidine (PubChem CID 87802569) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,2,3-trimethyl-1-prop-1-ynylguanidine.
| Compound Name | 1,2,3-trimethyl-1-prop-1-ynylguanidine |
|---|---|
| PubChem CID | 87802569 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1,2,3-trimethyl-1-prop-1-ynylguanidine |
| SMILES | CC#CN(C)/C(=N/C)NC |
| InChI | InChI=1S/C7H13N3/c1-5-6-10(4)7(8-2)9-3/h1-4H3,(H,8,9) |
| InChIKey | CYHPYHZFCFJZTI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|