C8H17N3 — CID 131097015
1-cyclobutyl-1,2,3-trimethylguanidine (PubChem CID 131097015) has the molecular formula C8H17N3 and a molecular weight of 155.25 g/mol. Its IUPAC name is 1-cyclobutyl-1,2,3-trimethylguanidine.
| Compound Name | 1-cyclobutyl-1,2,3-trimethylguanidine |
|---|---|
| PubChem CID | 131097015 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-cyclobutyl-1,2,3-trimethylguanidine |
| SMILES | C/N=C(\NC)N(C)C1CCC1 |
| InChI | InChI=1S/C8H17N3/c1-9-8(10-2)11(3)7-5-4-6-7/h7H,4-6H2,1-3H3,(H,9,10) |
| InChIKey | FJJZPAJDDUQCIF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|