C10H20N2S — CID 115576089
1-cycloheptyl-1,3-dimethylthiourea (PubChem CID 115576089) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 1-cycloheptyl-1,3-dimethylthiourea.
| Compound Name | 1-cycloheptyl-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 115576089 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-cycloheptyl-1,3-dimethylthiourea |
| SMILES | CNC(=S)N(C)C1CCCCCC1 |
| InChI | InChI=1S/C10H20N2S/c1-11-10(13)12(2)9-7-5-3-4-6-8-9/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | QJTAZBQTTQKDHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|