C8H16N2OS — CID 115669238
1,3-dimethyl-1-(oxan-4-yl)thiourea (PubChem CID 115669238) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is 1,3-dimethyl-1-(oxan-4-yl)thiourea.
| Compound Name | 1,3-dimethyl-1-(oxan-4-yl)thiourea |
|---|---|
| PubChem CID | 115669238 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 1,3-dimethyl-1-(oxan-4-yl)thiourea |
| SMILES | CNC(=S)N(C)C1CCOCC1 |
| InChI | InChI=1S/C8H16N2OS/c1-9-8(12)10(2)7-3-5-11-6-4-7/h7H,3-6H2,1-2H3,(H,9,12) |
| InChIKey | HZSNBRZGNKBBFN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|