C12H22N2O2S — CID 113270518
2-carbamothioyl-N,2-dimethyl-N-(oxan-4-yl)butanamide (PubChem CID 113270518) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-carbamothioyl-N,2-dimethyl-N-(oxan-4-yl)butanamide.
| Compound Name | 2-carbamothioyl-N,2-dimethyl-N-(oxan-4-yl)butanamide |
|---|---|
| PubChem CID | 113270518 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-carbamothioyl-N,2-dimethyl-N-(oxan-4-yl)butanamide |
| SMILES | CCC(C)(C(=O)N(C)C1CCOCC1)C(N)=S |
| InChI | InChI=1S/C12H22N2O2S/c1-4-12(2,10(13)17)11(15)14(3)9-5-7-16-8-6-9/h9H,4-8H2,1-3H3,(H2,13,17) |
| InChIKey | XEWRTIJHIOBTLD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|