C10H18FNO2 — CID 130165390
2-fluoro-N,2-dimethyl-N-(oxan-4-yl)propanamide (PubChem CID 130165390) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-fluoro-N,2-dimethyl-N-(oxan-4-yl)propanamide.
| Compound Name | 2-fluoro-N,2-dimethyl-N-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 130165390 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-fluoro-N,2-dimethyl-N-(oxan-4-yl)propanamide |
| SMILES | CN(C(=O)C(C)(C)F)C1CCOCC1 |
| InChI | InChI=1S/C10H18FNO2/c1-10(2,11)9(13)12(3)8-4-6-14-7-5-8/h8H,4-7H2,1-3H3 |
| InChIKey | QIEQSNOUAPDZBD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |