C9H15F3N2O2 — CID 115668200
1-methyl-1-(oxan-4-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115668200) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-methyl-1-(oxan-4-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-methyl-1-(oxan-4-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115668200 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-methyl-1-(oxan-4-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(C(=O)NCC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C9H15F3N2O2/c1-14(7-2-4-16-5-3-7)8(15)13-6-9(10,11)12/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | DBNUWXYLYLVNDB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |