C10H18F3N3O — CID 102639224
1-(2-aminocyclohexyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 102639224) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is 1-(2-aminocyclohexyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-aminocyclohexyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 102639224 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-(2-aminocyclohexyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(C(=O)NCC(F)(F)F)C1CCCCC1N |
| InChI | InChI=1S/C10H18F3N3O/c1-16(8-5-3-2-4-7(8)14)9(17)15-6-10(11,12)13/h7-8H,2-6,14H2,1H3,(H,15,17) |
| InChIKey | JGSCLWYQJGLRLF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |