C8H13Cl2NO2 — CID 131085788
2,2-dichloro-N-methyl-N-(oxolan-3-yl)propanamide (PubChem CID 131085788) has the molecular formula C8H13Cl2NO2 and a molecular weight of 226.10 g/mol. Its IUPAC name is 2,2-dichloro-N-methyl-N-(oxolan-3-yl)propanamide.
| Compound Name | 2,2-dichloro-N-methyl-N-(oxolan-3-yl)propanamide |
|---|---|
| PubChem CID | 131085788 |
| Molecular Formula | C8H13Cl2NO2 |
| Molecular Weight | 226.10 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 2,2-dichloro-N-methyl-N-(oxolan-3-yl)propanamide |
| SMILES | CN(C(=O)C(C)(Cl)Cl)C1CCOC1 |
| InChI | InChI=1S/C8H13Cl2NO2/c1-8(9,10)7(12)11(2)6-3-4-13-5-6/h6H,3-5H2,1-2H3 |
| InChIKey | BERWPBHPSNXUQR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.10 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|