C10H18N2O4 — CID 82742753
2-methyl-2-[[methyl(oxolan-3-yl)carbamoyl]amino]propanoic acid (PubChem CID 82742753) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-methyl-2-[[methyl(oxolan-3-yl)carbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[methyl(oxolan-3-yl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82742753 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-methyl-2-[[methyl(oxolan-3-yl)carbamoyl]amino]propanoic acid |
| SMILES | CN(C(=O)NC(C)(C)C(=O)O)C1CCOC1 |
| InChI | InChI=1S/C10H18N2O4/c1-10(2,8(13)14)11-9(15)12(3)7-4-5-16-6-7/h7H,4-6H2,1-3H3,(H,11,15)(H,13,14) |
| InChIKey | UVWDOETXLYWCSD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |