C8H15N — CID 135214583
(3E)-N,N,2-trimethylpenta-1,3-dien-3-amine (PubChem CID 135214583) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (3E)-N,N,2-trimethylpenta-1,3-dien-3-amine.
| Compound Name | (3E)-N,N,2-trimethylpenta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 135214583 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (3E)-N,N,2-trimethylpenta-1,3-dien-3-amine |
| SMILES | C=C(C)/C(=C\C)N(C)C |
| InChI | InChI=1S/C8H15N/c1-6-8(7(2)3)9(4)5/h6H,2H2,1,3-5H3/b8-6+ |
| InChIKey | ZBDSOJVKJXQBCC-SOFGYWHQSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|