C11H27N — CID 159548709
N,N-dimethylprop-1-en-2-amine;methane;2-methylprop-1-ene (PubChem CID 159548709) has the molecular formula C11H27N and a molecular weight of 173.34 g/mol. Its IUPAC name is N,N-dimethylprop-1-en-2-amine;methane;2-methylprop-1-ene.
| Compound Name | N,N-dimethylprop-1-en-2-amine;methane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 159548709 |
| Molecular Formula | C11H27N |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.21 |
| IUPAC Name | N,N-dimethylprop-1-en-2-amine;methane;2-methylprop-1-ene |
| SMILES | C.C.C=C(C)C.C=C(C)N(C)C |
| InChI | InChI=1S/C5H11N.C4H8.2CH4/c1-5(2)6(3)4;1-4(2)3;;/h1H2,2-4H3;1H2,2-3H3;2*1H4 |
| InChIKey | MFCTYZVVHKFURV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|