C14H21NO3 — CID 2254858
ethyl (2Z,4E)-2-acetyl-5-(dimethylamino)-6-methylhepta-2,4,6-trienoate (PubChem CID 2254858) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-acetyl-5-(dimethylamino)-6-methylhepta-2,4,6-trienoate.
| Compound Name | ethyl (2Z,4E)-2-acetyl-5-(dimethylamino)-6-methylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 2254858 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethyl (2Z,4E)-2-acetyl-5-(dimethylamino)-6-methylhepta-2,4,6-trienoate |
| SMILES | C=C(C)/C(=C\C=C(\C(C)=O)C(=O)OCC)N(C)C |
| InChI | InChI=1S/C14H21NO3/c1-7-18-14(17)12(11(4)16)8-9-13(10(2)3)15(5)6/h8-9H,2,7H2,1,3-6H3/b12-8-,13-9+ |
| InChIKey | IGNOBICKNVXBJC-QRBCZBMESA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|