C10H14 — CID 142147647
(3Z,5E)-4-prop-1-en-2-ylhepta-1,3,5-triene (PubChem CID 142147647) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (3Z,5E)-4-prop-1-en-2-ylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-4-prop-1-en-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142147647 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (3Z,5E)-4-prop-1-en-2-ylhepta-1,3,5-triene |
| SMILES | C=C/C=C(/C=C/C)C(=C)C |
| InChI | InChI=1S/C10H14/c1-5-7-10(8-6-2)9(3)4/h5-8H,1,3H2,2,4H3/b8-6+,10-7- |
| InChIKey | APRMXLAHOYRVOF-ZPNWEIAESA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|