C9H20S — CID 143502225
ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol (PubChem CID 143502225) has the molecular formula C9H20S and a molecular weight of 160.33 g/mol. Its IUPAC name is ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol.
| Compound Name | ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 143502225 |
| Molecular Formula | C9H20S |
| Molecular Weight | 160.33 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | ethane;(1Z)-2-methylbuta-1,3-diene-1-thiol |
| SMILES | C=C/C(C)=C\S.CC.CC |
| InChI | InChI=1S/C5H8S.2C2H6/c1-3-5(2)4-6;2*1-2/h3-4,6H,1H2,2H3;2*1-2H3/b5-4-;; |
| InChIKey | NSHYIOBWCYPKEQ-WNCVTPEDSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|