C14H26N2 — CID 143256761
ethane;[(3Z)-3-ethenyl-5-methylhexa-1,3,5-trien-2-yl]-methyldiazene (PubChem CID 143256761) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;[(3Z)-3-ethenyl-5-methylhexa-1,3,5-trien-2-yl]-methyldiazene.
| Compound Name | ethane;[(3Z)-3-ethenyl-5-methylhexa-1,3,5-trien-2-yl]-methyldiazene |
|---|---|
| PubChem CID | 143256761 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;[(3Z)-3-ethenyl-5-methylhexa-1,3,5-trien-2-yl]-methyldiazene |
| SMILES | C=C/C(=C/C(=C)C)C(=C)/N=N/C.CC.CC |
| InChI | InChI=1S/C10H14N2.2C2H6/c1-6-10(7-8(2)3)9(4)12-11-5;2*1-2/h6-7H,1-2,4H2,3,5H3;2*1-2H3/b10-7-,12-11+;; |
| InChIKey | HFEFPXUEXQNWLK-GXFXOYQBSA-N |
| XLogP | 5.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|