C7H9ClN2 — CID 142981168
[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-methyldiazene (PubChem CID 142981168) has the molecular formula C7H9ClN2 and a molecular weight of 156.62 g/mol. Its IUPAC name is [(3E)-3-chlorohexa-1,3,5-trien-2-yl]-methyldiazene.
| Compound Name | [(3E)-3-chlorohexa-1,3,5-trien-2-yl]-methyldiazene |
|---|---|
| PubChem CID | 142981168 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | [(3E)-3-chlorohexa-1,3,5-trien-2-yl]-methyldiazene |
| SMILES | C=C/C=C(/Cl)C(=C)/N=N/C |
| InChI | InChI=1S/C7H9ClN2/c1-4-5-7(8)6(2)10-9-3/h4-5H,1-2H2,3H3/b7-5+,10-9+ |
| InChIKey | ITKDZBWJDSFDMC-GLVZAGOZSA-N |
| XLogP | 2.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|