C7H8Cl2OS — CID 123482550
chloro-(3-chlorohexa-1,3,5-trien-2-yl)-methylidene-oxo-λ6-sulfane (PubChem CID 123482550) has the molecular formula C7H8Cl2OS and a molecular weight of 211.11 g/mol. Its IUPAC name is chloro-(3-chlorohexa-1,3,5-trien-2-yl)-methylidene-oxo-λ6-sulfane.
| Compound Name | chloro-(3-chlorohexa-1,3,5-trien-2-yl)-methylidene-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 123482550 |
| Molecular Formula | C7H8Cl2OS |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | chloro-(3-chlorohexa-1,3,5-trien-2-yl)-methylidene-oxo-λ6-sulfane |
| SMILES | C=CC=C(Cl)C(=C)S(=C)(=O)Cl |
| InChI | InChI=1S/C7H8Cl2OS/c1-4-5-7(8)6(2)11(3,9)10/h4-5H,1-3H2 |
| InChIKey | CRUKPHDZVQKLEQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|