C5H7ClSe — CID 71382576
1-chloro-1-methylselanylbuta-1,3-diene (PubChem CID 71382576) has the molecular formula C5H7ClSe and a molecular weight of 181.52 g/mol. Its IUPAC name is 1-chloro-1-methylselanylbuta-1,3-diene.
| Compound Name | 1-chloro-1-methylselanylbuta-1,3-diene |
|---|---|
| PubChem CID | 71382576 |
| Molecular Formula | C5H7ClSe |
| Molecular Weight | 181.52 g/mol |
| Exact Mass | 181.94 |
| IUPAC Name | 1-chloro-1-methylselanylbuta-1,3-diene |
| SMILES | C=CC=C(Cl)[Se]C |
| InChI | InChI=1S/C5H7ClSe/c1-3-4-5(6)7-2/h3-4H,1H2,2H3 |
| InChIKey | JHOUZYCOXWOECB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|