C9H9Cl3 — CID 138714273
(3E,6Z)-4,6,7-trichloro-5-methylideneocta-1,3,6-triene (PubChem CID 138714273) has the molecular formula C9H9Cl3 and a molecular weight of 223.53 g/mol. Its IUPAC name is (3E,6Z)-4,6,7-trichloro-5-methylideneocta-1,3,6-triene.
| Compound Name | (3E,6Z)-4,6,7-trichloro-5-methylideneocta-1,3,6-triene |
|---|---|
| PubChem CID | 138714273 |
| Molecular Formula | C9H9Cl3 |
| Molecular Weight | 223.53 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | (3E,6Z)-4,6,7-trichloro-5-methylideneocta-1,3,6-triene |
| SMILES | C=C/C=C(/Cl)C(=C)/C(Cl)=C(\C)Cl |
| InChI | InChI=1S/C9H9Cl3/c1-4-5-8(11)6(2)9(12)7(3)10/h4-5H,1-2H2,3H3/b8-5+,9-7- |
| InChIKey | FIWOOIXIRVBCNL-KCGQVOQMSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|