C7H10ClN — CID 144929616
(2E)-3-chloro-N,4-dimethylpenta-2,4-dien-1-imine (PubChem CID 144929616) has the molecular formula C7H10ClN and a molecular weight of 143.62 g/mol. Its IUPAC name is (2E)-3-chloro-N,4-dimethylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-3-chloro-N,4-dimethylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144929616 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | (2E)-3-chloro-N,4-dimethylpenta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(Cl)=C\C=N\C |
| InChI | InChI=1S/C7H10ClN/c1-6(2)7(8)4-5-9-3/h4-5H,1H2,2-3H3/b7-4+,9-5+ |
| InChIKey | DLEDOTHCMDTXSV-XCIOYXGDSA-N |
| XLogP | 2.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|