C9H19N — CID 163403492
N,3-dimethylbut-2-en-1-imine;propane (PubChem CID 163403492) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is N,3-dimethylbut-2-en-1-imine;propane.
| Compound Name | N,3-dimethylbut-2-en-1-imine;propane |
|---|---|
| PubChem CID | 163403492 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | N,3-dimethylbut-2-en-1-imine;propane |
| SMILES | C/N=C/C=C(C)C.CCC |
| InChI | InChI=1S/C6H11N.C3H8/c1-6(2)4-5-7-3;1-3-2/h4-5H,1-3H3;3H2,1-2H3/b7-5+; |
| InChIKey | FRZJYEGYNJDGHN-GZOLSCHFSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|