C8H15N3 — CID 163245039
(2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine (PubChem CID 163245039) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is (2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine.
| Compound Name | (2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 163245039 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine |
| SMILES | C/N=C/C=C(/C=C(C)C)NN |
| InChI | InChI=1S/C8H15N3/c1-7(2)6-8(11-9)4-5-10-3/h4-6,11H,9H2,1-3H3/b8-4-,10-5+ |
| InChIKey | KJLRTXOMEYLPCV-HZEUFOEUSA-N |
| XLogP | 1.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|