C14H29N3 — CID 163245038
(E)-but-2-ene;ethane;(2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine (PubChem CID 163245038) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is (E)-but-2-ene;ethane;(2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine.
| Compound Name | (E)-but-2-ene;ethane;(2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 163245038 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | (E)-but-2-ene;ethane;(2Z)-3-hydrazinyl-N,5-dimethylhexa-2,4-dien-1-imine |
| SMILES | C/C=C/C.C/N=C/C=C(/C=C(C)C)NN.CC |
| InChI | InChI=1S/C8H15N3.C4H8.C2H6/c1-7(2)6-8(11-9)4-5-10-3;1-3-4-2;1-2/h4-6,11H,9H2,1-3H3;3-4H,1-2H3;1-2H3/b8-4-,10-5+;4-3+; |
| InChIKey | FODHVGGAKWPBOC-UIDBVFCISA-N |
| XLogP | 3.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|