C8H10ClN — CID 134534701
(2E)-4-chloro-3-ethenyl-N-methylpenta-2,4-dien-1-imine (PubChem CID 134534701) has the molecular formula C8H10ClN and a molecular weight of 155.63 g/mol. Its IUPAC name is (2E)-4-chloro-3-ethenyl-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-4-chloro-3-ethenyl-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 134534701 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | (2E)-4-chloro-3-ethenyl-N-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C(=C\C=N\C)C(=C)Cl |
| InChI | InChI=1S/C8H10ClN/c1-4-8(7(2)9)5-6-10-3/h4-6H,1-2H2,3H3/b8-5+,10-6+ |
| InChIKey | DTFBSSKKSPIWEJ-YLDLMLGBSA-N |
| XLogP | 2.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|