C5H7ClN2 — CID 91227377
N'-(1-chloroethenyl)-N-methylethane-1,2-diimine (PubChem CID 91227377) has the molecular formula C5H7ClN2 and a molecular weight of 130.58 g/mol. Its IUPAC name is N'-(1-chloroethenyl)-N-methylethane-1,2-diimine.
| Compound Name | N'-(1-chloroethenyl)-N-methylethane-1,2-diimine |
|---|---|
| PubChem CID | 91227377 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | N'-(1-chloroethenyl)-N-methylethane-1,2-diimine |
| SMILES | C=C(Cl)N=C/C=N/C |
| InChI | InChI=1S/C5H7ClN2/c1-5(6)8-4-3-7-2/h3-4H,1H2,2H3/b7-3+,8-4? |
| InChIKey | MMNTVNKKOMJVPC-OJQZMLLLSA-N |
| XLogP | 1.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|