C13H17N — CID 166829969
(Z)-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-2-methylbut-2-en-1-imine (PubChem CID 166829969) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (Z)-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-2-methylbut-2-en-1-imine.
| Compound Name | (Z)-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-2-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 166829969 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (Z)-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-2-methylbut-2-en-1-imine |
| SMILES | C=C/C=C(\C=C)C(=C)/N=C\C(C)=C/C |
| InChI | InChI=1S/C13H17N/c1-6-9-13(8-3)12(5)14-10-11(4)7-2/h6-10H,1,3,5H2,2,4H3/b11-7-,13-9+,14-10+ |
| InChIKey | QVOYYIKBSANNOY-FYPKJBHBSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|